![[ICO]](/icons/blank.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| (#55) this is the on..> | 2024-08-16 17:48 | 5.8G | |
| Ashley Diary Series ..> | 2023-08-28 20:13 | 722M | |
| Candy Pants/ | 2023-03-27 18:52 | - | |
| Dark Angel - The Vid..> | 2023-03-27 18:52 | - | |
| It's Me (The Hitler)..> | 2023-10-07 20:13 | - | |
| It's Me JOE BIDEN (A..> | 2023-08-26 19:02 | 53M | |
| Jessica Files/ | 2023-05-07 17:40 | - | |
| LIVE Donald Trump an..> | 2023-09-03 11:19 | - | |
| Me Marrying My Half ..> | 2023-03-27 18:52 | - | |
| Me Marrying My Half ..> | 2023-03-27 18:52 | - | |
| Sexercise & Mental H..> | 2024-08-12 04:53 | - | |
| Slut Cops - The Vide..> | 2023-05-07 17:13 | - | |
| Split 2.iso | 2024-07-21 20:10 | 597M | |
| The Compound/ | 2023-03-27 18:52 | - | |
| The Jules Files/ | 2023-03-27 18:52 | - | |
| The Myra Files/ | 2023-03-27 18:53 | - | |
| The Pandemic and The..> | 2023-09-04 20:15 | 1.2G | |
| Trans Conservatives ..> | 2024-08-01 15:13 | 772M | |
| We The People.mp4 | 2023-10-02 21:03 | 1.5G | |
| zzz Makeup Files and..> | 2023-03-27 18:53 | - | |
| zzzz Sports Entertai..> | 2024-01-20 15:52 | - | |